C13H12N2O — CID 164736959
1-propyl-[1,2]oxazolo[4,5-f]quinoline (PubChem CID 164736959) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-propyl-[1,2]oxazolo[4,5-f]quinoline.
| Compound Name | 1-propyl-[1,2]oxazolo[4,5-f]quinoline |
|---|---|
| PubChem CID | 164736959 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 1-propyl-[1,2]oxazolo[4,5-f]quinoline |
| SMILES | CCCc1noc2ccc3ncccc3c12 |
| InChI | InChI=1S/C13H12N2O/c1-2-4-11-13-9-5-3-8-14-10(9)6-7-12(13)16-15-11/h3,5-8H,2,4H2,1H3 |
| InChIKey | IKDROJGMHIVQOC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |