C12H6ClIN2 — CID 163214528
5-chloro-6-iodo-1,10-phenanthroline (PubChem CID 163214528) has the molecular formula C12H6ClIN2 and a molecular weight of 340.55 g/mol. Its IUPAC name is 5-chloro-6-iodo-1,10-phenanthroline.
| Compound Name | 5-chloro-6-iodo-1,10-phenanthroline |
|---|---|
| PubChem CID | 163214528 |
| Molecular Formula | C12H6ClIN2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | 5-chloro-6-iodo-1,10-phenanthroline |
| SMILES | Clc1c(I)c2cccnc2c2ncccc12 |
| InChI | InChI=1S/C12H6ClIN2/c13-9-7-3-1-5-15-11(7)12-8(10(9)14)4-2-6-16-12/h1-6H |
| InChIKey | GARLJYQQGZKWGY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|