C12H11NO — CID 97036783
(2S)-2-methyl-1,2-dihydrofuro[3,2-f]quinoline (PubChem CID 97036783) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is (2S)-2-methyl-1,2-dihydrofuro[3,2-f]quinoline.
| Compound Name | (2S)-2-methyl-1,2-dihydrofuro[3,2-f]quinoline |
|---|---|
| PubChem CID | 97036783 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (2S)-2-methyl-1,2-dihydrofuro[3,2-f]quinoline |
| SMILES | C[C@H]1Cc2c(ccc3ncccc23)O1 |
| InChI | InChI=1S/C12H11NO/c1-8-7-10-9-3-2-6-13-11(9)4-5-12(10)14-8/h2-6,8H,7H2,1H3/t8-/m0/s1 |
| InChIKey | UYHGCSINTBGVCX-QMMMGPOBSA-N |
| XLogP | 2.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |