C10H11N3 — CID 154402299
5-N-methylquinoline-5,6-diamine (PubChem CID 154402299) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 5-N-methylquinoline-5,6-diamine.
| Compound Name | 5-N-methylquinoline-5,6-diamine |
|---|---|
| PubChem CID | 154402299 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 5-N-methylquinoline-5,6-diamine |
| SMILES | CNc1c(N)ccc2ncccc12 |
| InChI | InChI=1S/C10H11N3/c1-12-10-7-3-2-6-13-9(7)5-4-8(10)11/h2-6,12H,11H2,1H3 |
| InChIKey | ZDEOSWJATAMVIP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|