About 5-N-methylquinoline-5,7-diamine
5-N-methylquinoline-5,7-diamine (PubChem CID 141364449) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is 5-N-methylquinoline-5,7-diamine.
Molecular Properties
| Compound Name | 5-N-methylquinoline-5,7-diamine |
| PubChem CID | 141364449 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 5-N-methylquinoline-5,7-diamine |
| SMILES | CNc1cc(N)cc2ncccc12 |
| InChI | InChI=1S/C10H11N3/c1-12-9-5-7(11)6-10-8(9)3-2-4-13-10/h2-6,12H,11H2,1H3 |
| InChIKey | SODIATLSNPRXFZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-N-methylquinoline-5,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-methylquinoline-5,7-diamine?
The IUPAC name of 5-N-methylquinoline-5,7-diamine (CID 141364449) is 5-N-methylquinoline-5,7-diamine.
What is the SMILES notation for 5-N-methylquinoline-5,7-diamine?
The canonical SMILES for 5-N-methylquinoline-5,7-diamine is CNc1cc(N)cc2ncccc12.
What is the InChIKey of 5-N-methylquinoline-5,7-diamine?
The InChIKey is SODIATLSNPRXFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-12-9-5-7(11)6-10-8(9)3-2-4-13-10/h2-6,12H,11H2,1H3.
What are the key properties of 5-N-methylquinoline-5,7-diamine?
5-N-methylquinoline-5,7-diamine has a molecular weight of 173.22 g/mol, XLogP of 1.86, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-methylquinoline-5,7-diamine is sourced from PubChem (CID 141364449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).