C12H15N3 — CID 14579986
4-N,7-N,7-N-trimethylquinoline-4,7-diamine (PubChem CID 14579986) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-N,7-N,7-N-trimethylquinoline-4,7-diamine.
| Compound Name | 4-N,7-N,7-N-trimethylquinoline-4,7-diamine |
|---|---|
| PubChem CID | 14579986 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4-N,7-N,7-N-trimethylquinoline-4,7-diamine |
| SMILES | CNc1ccnc2cc(N(C)C)ccc12 |
| InChI | InChI=1S/C12H15N3/c1-13-11-6-7-14-12-8-9(15(2)3)4-5-10(11)12/h4-8H,1-3H3,(H,13,14) |
| InChIKey | BMPFEDLQNLUMNA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |