C27H17N — CID 134428620
(1Z,7Z,13Z,19E)-25-azahexacyclo[18.8.0.02,7.08,13.014,19.021,26]octacosa-1,3,5,7,9,11,13,15,17,19,21(26),22,24,27-tetradecaene (PubChem CID 134428620) has the molecular formula C27H17N and a molecular weight of 355.44 g/mol. Its IUPAC name is (1Z,7Z,13Z,19E)-25-azahexacyclo[18.8.0.02,7.08,13.014,19.021,26]octacosa-1,3,5,7,9,11,13,15,17,19,21(26),22,24,27-tetradecaene.
| Compound Name | (1Z,7Z,13Z,19E)-25-azahexacyclo[18.8.0.02,7.08,13.014,19.021,26]octacosa-1,3,5,7,9,11,13,15,17,19,21(26),22,24,27-tetradecaene |
|---|---|
| PubChem CID | 134428620 |
| Molecular Formula | C27H17N |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (1Z,7Z,13Z,19E)-25-azahexacyclo[18.8.0.02,7.08,13.014,19.021,26]octacosa-1,3,5,7,9,11,13,15,17,19,21(26),22,24,27-tetradecaene |
| SMILES | c1ccc2/c(c1)=c1/cccc/c1=c1\ccc3ncccc3\c1=c1/cccc/c1=2 |
| InChI | InChI=1S/C27H17N/c1-2-9-19-18(8-1)20-10-3-4-12-22(20)24-15-16-26-25(14-7-17-28-26)27(24)23-13-6-5-11-21(19)23/h1-17H/b20-18-,21-19-,24-22-,27-23+ |
| InChIKey | LLXPBYHCBSDLQK-IPIAKPPJSA-N |
| XLogP | 5.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |