About 6-bromoquinoline-5-thiol
6-bromoquinoline-5-thiol (PubChem CID 136981755) has the molecular formula C9H6BrNS
and a molecular weight of 240.13 g/mol. Its IUPAC name is 6-bromoquinoline-5-thiol.
Molecular Properties
| Compound Name | 6-bromoquinoline-5-thiol |
| PubChem CID | 136981755 |
| Molecular Formula | C9H6BrNS |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 238.94 |
| IUPAC Name | 6-bromoquinoline-5-thiol |
| SMILES | Sc1c(Br)ccc2ncccc12 |
| InChI | InChI=1S/C9H6BrNS/c10-7-3-4-8-6(9(7)12)2-1-5-11-8/h1-5,12H |
| InChIKey | GYPLFMXMHVDNTL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-bromoquinoline-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromoquinoline-5-thiol?
The IUPAC name of 6-bromoquinoline-5-thiol (CID 136981755) is 6-bromoquinoline-5-thiol.
What is the SMILES notation for 6-bromoquinoline-5-thiol?
The canonical SMILES for 6-bromoquinoline-5-thiol is Sc1c(Br)ccc2ncccc12.
What is the InChIKey of 6-bromoquinoline-5-thiol?
The InChIKey is GYPLFMXMHVDNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrNS/c10-7-3-4-8-6(9(7)12)2-1-5-11-8/h1-5,12H.
What are the key properties of 6-bromoquinoline-5-thiol?
6-bromoquinoline-5-thiol has a molecular weight of 240.13 g/mol, XLogP of 3.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromoquinoline-5-thiol is sourced from PubChem (CID 136981755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).