About 6-azido-5-bromoquinoline
6-azido-5-bromoquinoline (PubChem CID 152531044) has the molecular formula C9H5BrN4
and a molecular weight of 249.07 g/mol. Its IUPAC name is 6-azido-5-bromoquinoline.
Molecular Properties
| Compound Name | 6-azido-5-bromoquinoline |
| PubChem CID | 152531044 |
| Molecular Formula | C9H5BrN4 |
| Molecular Weight | 249.07 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 6-azido-5-bromoquinoline |
| SMILES | [N-]=[N+]=Nc1ccc2ncccc2c1Br |
| InChI | InChI=1S/C9H5BrN4/c10-9-6-2-1-5-12-7(6)3-4-8(9)13-14-11/h1-5H |
| InChIKey | YJNUUHYISIZJBW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.07 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azido-5-bromoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azido-5-bromoquinoline?
The IUPAC name of 6-azido-5-bromoquinoline (CID 152531044) is 6-azido-5-bromoquinoline.
What is the SMILES notation for 6-azido-5-bromoquinoline?
The canonical SMILES for 6-azido-5-bromoquinoline is [N-]=[N+]=Nc1ccc2ncccc2c1Br.
What is the InChIKey of 6-azido-5-bromoquinoline?
The InChIKey is YJNUUHYISIZJBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN4/c10-9-6-2-1-5-12-7(6)3-4-8(9)13-14-11/h1-5H.
What are the key properties of 6-azido-5-bromoquinoline?
6-azido-5-bromoquinoline has a molecular weight of 249.07 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azido-5-bromoquinoline is sourced from PubChem (CID 152531044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).