C13H11Br3N2 — CID 118731126
6-bromo-5-[(3R,4R)-3,4-dibromopyrrolidin-1-yl]quinoline (PubChem CID 118731126) has the molecular formula C13H11Br3N2 and a molecular weight of 434.96 g/mol. Its IUPAC name is 6-bromo-5-[(3R,4R)-3,4-dibromopyrrolidin-1-yl]quinoline.
| Compound Name | 6-bromo-5-[(3R,4R)-3,4-dibromopyrrolidin-1-yl]quinoline |
|---|---|
| PubChem CID | 118731126 |
| Molecular Formula | C13H11Br3N2 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 431.85 |
| IUPAC Name | 6-bromo-5-[(3R,4R)-3,4-dibromopyrrolidin-1-yl]quinoline |
| SMILES | Brc1ccc2ncccc2c1N1C[C@@H](Br)[C@H](Br)C1 |
| InChI | InChI=1S/C13H11Br3N2/c14-9-3-4-12-8(2-1-5-17-12)13(9)18-6-10(15)11(16)7-18/h1-5,10-11H,6-7H2/t10-,11-/m1/s1 |
| InChIKey | KKJBVPXENGIDIN-GHMZBOCLSA-N |
| XLogP | 4.34 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|