C15H9NS2 — CID 141246447
[1,4]benzodithiino[2,3-f]quinoline (PubChem CID 141246447) has the molecular formula C15H9NS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is [1,4]benzodithiino[2,3-f]quinoline.
| Compound Name | [1,4]benzodithiino[2,3-f]quinoline |
|---|---|
| PubChem CID | 141246447 |
| Molecular Formula | C15H9NS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | [1,4]benzodithiino[2,3-f]quinoline |
| SMILES | c1ccc2c(c1)Sc1ccc3ncccc3c1S2 |
| InChI | InChI=1S/C15H9NS2/c1-2-6-13-12(5-1)17-14-8-7-11-10(15(14)18-13)4-3-9-16-11/h1-9H |
| InChIKey | IGCREGFEOVJBLZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |