C11H9N3 — CID 86190920
1,4-dihydropyrido[2,3-h]quinazoline (PubChem CID 86190920) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1,4-dihydropyrido[2,3-h]quinazoline.
| Compound Name | 1,4-dihydropyrido[2,3-h]quinazoline |
|---|---|
| PubChem CID | 86190920 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 1,4-dihydropyrido[2,3-h]quinazoline |
| SMILES | C1=NCc2ccc3ncccc3c2N1 |
| InChI | InChI=1S/C11H9N3/c1-2-9-10(13-5-1)4-3-8-6-12-7-14-11(8)9/h1-5,7H,6H2,(H,12,14) |
| InChIKey | ASFJBLCPVMHJLT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |