C10H7N3O — CID 67796235
2H-pyrido[2,3-h][1,2,3]benzoxadiazine (PubChem CID 67796235) has the molecular formula C10H7N3O and a molecular weight of 185.19 g/mol. Its IUPAC name is 2H-pyrido[2,3-h][1,2,3]benzoxadiazine.
| Compound Name | 2H-pyrido[2,3-h][1,2,3]benzoxadiazine |
|---|---|
| PubChem CID | 67796235 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2H-pyrido[2,3-h][1,2,3]benzoxadiazine |
| SMILES | C1=NNOc2c1ccc1ncccc21 |
| InChI | InChI=1S/C10H7N3O/c1-2-8-9(11-5-1)4-3-7-6-12-13-14-10(7)8/h1-6,13H |
| InChIKey | ZGTKLSBKCJXKMZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |