C12H10N2O — CID 141103735
2H-pyrano[2,3-f]quinolin-3-amine (PubChem CID 141103735) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 2H-pyrano[2,3-f]quinolin-3-amine.
| Compound Name | 2H-pyrano[2,3-f]quinolin-3-amine |
|---|---|
| PubChem CID | 141103735 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2H-pyrano[2,3-f]quinolin-3-amine |
| SMILES | NC1=Cc2ccc3ncccc3c2OC1 |
| InChI | InChI=1S/C12H10N2O/c13-9-6-8-3-4-11-10(2-1-5-14-11)12(8)15-7-9/h1-6H,7,13H2 |
| InChIKey | ZGHYEPHLXICJKZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |