C11H9N5S — CID 43809899
6-(1H-1,2,4-triazol-5-ylsulfanyl)quinolin-5-amine (PubChem CID 43809899) has the molecular formula C11H9N5S and a molecular weight of 243.30 g/mol. Its IUPAC name is 6-(1H-1,2,4-triazol-5-ylsulfanyl)quinolin-5-amine.
| Compound Name | 6-(1H-1,2,4-triazol-5-ylsulfanyl)quinolin-5-amine |
|---|---|
| PubChem CID | 43809899 |
| Molecular Formula | C11H9N5S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-(1H-1,2,4-triazol-5-ylsulfanyl)quinolin-5-amine |
| SMILES | Nc1c(Sc2ncn[nH]2)ccc2ncccc12 |
| InChI | InChI=1S/C11H9N5S/c12-10-7-2-1-5-13-8(7)3-4-9(10)17-11-14-6-15-16-11/h1-6H,12H2,(H,14,15,16) |
| InChIKey | YWUVCLNVRNXOJA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|