About 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one
3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one (PubChem CID 80501235) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one.
Molecular Properties
| Compound Name | 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one |
| PubChem CID | 80501235 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one |
| SMILES | CC1(C)C(=O)Nc2c1ccc1ncccc21 |
| InChI | InChI=1S/C13H12N2O/c1-13(2)9-5-6-10-8(4-3-7-14-10)11(9)15-12(13)16/h3-7H,1-2H3,(H,15,16) |
| InChIKey | WWBRXLPQFTVUDE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one?
The IUPAC name of 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one (CID 80501235) is 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one.
What is the SMILES notation for 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one?
The canonical SMILES for 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one is CC1(C)C(=O)Nc2c1ccc1ncccc21.
What is the InChIKey of 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one?
The InChIKey is WWBRXLPQFTVUDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c1-13(2)9-5-6-10-8(4-3-7-14-10)11(9)15-12(13)16/h3-7H,1-2H3,(H,15,16).
What are the key properties of 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one?
3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one has a molecular weight of 212.25 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1H-pyrrolo[2,3-f]quinolin-2-one is sourced from PubChem (CID 80501235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).