C17H21N3OS — CID 21271610
4-[2-(dimethylamino)ethyl]-2-methyl-3,4-dihydropyrido[3,2-g][1,4]benzoxazepine-1-thione (PubChem CID 21271610) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-2-methyl-3,4-dihydropyrido[3,2-g][1,4]benzoxazepine-1-thione.
| Compound Name | 4-[2-(dimethylamino)ethyl]-2-methyl-3,4-dihydropyrido[3,2-g][1,4]benzoxazepine-1-thione |
|---|---|
| PubChem CID | 21271610 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-2-methyl-3,4-dihydropyrido[3,2-g][1,4]benzoxazepine-1-thione |
| SMILES | CN(C)CCC1CN(C)C(=S)c2c(ccc3ncccc23)O1 |
| InChI | InChI=1S/C17H21N3OS/c1-19(2)10-8-12-11-20(3)17(22)16-13-5-4-9-18-14(13)6-7-15(16)21-12/h4-7,9,12H,8,10-11H2,1-3H3 |
| InChIKey | RRGXCFRIJDEENX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|