C18H23N3OS — CID 21271458
2-[2-(dimethylamino)ethyl]-4,10-dimethyl-2,3-dihydropyrido[3,2-i][1,4]benzoxazepine-5-thione (PubChem CID 21271458) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-4,10-dimethyl-2,3-dihydropyrido[3,2-i][1,4]benzoxazepine-5-thione.
| Compound Name | 2-[2-(dimethylamino)ethyl]-4,10-dimethyl-2,3-dihydropyrido[3,2-i][1,4]benzoxazepine-5-thione |
|---|---|
| PubChem CID | 21271458 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-4,10-dimethyl-2,3-dihydropyrido[3,2-i][1,4]benzoxazepine-5-thione |
| SMILES | Cc1ccc2ccc3c(c2n1)OC(CCN(C)C)CN(C)C3=S |
| InChI | InChI=1S/C18H23N3OS/c1-12-5-6-13-7-8-15-17(16(13)19-12)22-14(9-10-20(2)3)11-21(4)18(15)23/h5-8,14H,9-11H2,1-4H3 |
| InChIKey | TUBMZLCXLDGMEO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|