C16H17ClN2O2 — CID 21271522
2-(2-chloroethyl)-4,7-dimethyl-2,3-dihydropyrido[3,2-i][1,4]benzoxazepin-5-one (PubChem CID 21271522) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4,7-dimethyl-2,3-dihydropyrido[3,2-i][1,4]benzoxazepin-5-one.
| Compound Name | 2-(2-chloroethyl)-4,7-dimethyl-2,3-dihydropyrido[3,2-i][1,4]benzoxazepin-5-one |
|---|---|
| PubChem CID | 21271522 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-(2-chloroethyl)-4,7-dimethyl-2,3-dihydropyrido[3,2-i][1,4]benzoxazepin-5-one |
| SMILES | Cc1cc2c(c3ncccc13)OC(CCCl)CN(C)C2=O |
| InChI | InChI=1S/C16H17ClN2O2/c1-10-8-13-15(14-12(10)4-3-7-18-14)21-11(5-6-17)9-19(2)16(13)20/h3-4,7-8,11H,5-6,9H2,1-2H3 |
| InChIKey | CPFPYNLCRRZDGV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|