C16H22Cl2N2O2 — CID 21271482
2-(2-chloroethyl)-4-cyclohexyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one;hydrochloride (PubChem CID 21271482) has the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.27 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4-cyclohexyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one;hydrochloride.
| Compound Name | 2-(2-chloroethyl)-4-cyclohexyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one;hydrochloride |
|---|---|
| PubChem CID | 21271482 |
| Molecular Formula | C16H22Cl2N2O2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-(2-chloroethyl)-4-cyclohexyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one;hydrochloride |
| SMILES | Cl.O=C1c2cccnc2OC(CCCl)CN1C1CCCCC1 |
| InChI | InChI=1S/C16H21ClN2O2.ClH/c17-9-8-13-11-19(12-5-2-1-3-6-12)16(20)14-7-4-10-18-15(14)21-13;/h4,7,10,12-13H,1-3,5-6,8-9,11H2;1H |
| InChIKey | JBOHPFYDFLKAKI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|