C16H21N3O2 — CID 125418523
(3S,7R)-5-cyclopentyl-8-methyl-2-oxa-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-9-one (PubChem CID 125418523) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (3S,7R)-5-cyclopentyl-8-methyl-2-oxa-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-9-one.
| Compound Name | (3S,7R)-5-cyclopentyl-8-methyl-2-oxa-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-9-one |
|---|---|
| PubChem CID | 125418523 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (3S,7R)-5-cyclopentyl-8-methyl-2-oxa-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-9-one |
| SMILES | CN1C(=O)c2cccnc2O[C@H]2CN(C3CCCC3)C[C@H]21 |
| InChI | InChI=1S/C16H21N3O2/c1-18-13-9-19(11-5-2-3-6-11)10-14(13)21-15-12(16(18)20)7-4-8-17-15/h4,7-8,11,13-14H,2-3,5-6,9-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | URXDVXVCODBKTQ-KGLIPLIRSA-N |
| XLogP | 1.54 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |