C19H17ClF3NO2 — CID 21271453
2-(2-chloroethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 21271453) has the molecular formula C19H17ClF3NO2 and a molecular weight of 383.80 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 2-(2-chloroethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 21271453 |
| Molecular Formula | C19H17ClF3NO2 |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-(2-chloroethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | O=C1c2ccccc2OC(CCCl)CN1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17ClF3NO2/c20-9-8-15-12-24(18(25)16-6-1-2-7-17(16)26-15)11-13-4-3-5-14(10-13)19(21,22)23/h1-7,10,15H,8-9,11-12H2 |
| InChIKey | XDDJXAXAKOZXSM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|