C14H15ClN2O2S — CID 104774152
5-(3-chloropyrrolidin-1-yl)sulfonyl-8-methylquinoline (PubChem CID 104774152) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 5-(3-chloropyrrolidin-1-yl)sulfonyl-8-methylquinoline.
| Compound Name | 5-(3-chloropyrrolidin-1-yl)sulfonyl-8-methylquinoline |
|---|---|
| PubChem CID | 104774152 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 5-(3-chloropyrrolidin-1-yl)sulfonyl-8-methylquinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(Cl)C2)c2cccnc12 |
| InChI | InChI=1S/C14H15ClN2O2S/c1-10-4-5-13(12-3-2-7-16-14(10)12)20(18,19)17-8-6-11(15)9-17/h2-5,7,11H,6,8-9H2,1H3 |
| InChIKey | UXDJOCMYDFEYRE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|