C18H26ClN3O3S — CID 119992673
3-[1-(8-methylquinolin-5-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride (PubChem CID 119992673) has the molecular formula C18H26ClN3O3S and a molecular weight of 399.94 g/mol. Its IUPAC name is 3-[1-(8-methylquinolin-5-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride.
| Compound Name | 3-[1-(8-methylquinolin-5-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119992673 |
| Molecular Formula | C18H26ClN3O3S |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-[1-(8-methylquinolin-5-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(OCCCN)CC2)c2cccnc12.Cl |
| InChI | InChI=1S/C18H25N3O3S.ClH/c1-14-5-6-17(16-4-2-10-20-18(14)16)25(22,23)21-11-7-15(8-12-21)24-13-3-9-19;/h2,4-6,10,15H,3,7-9,11-13,19H2,1H3;1H |
| InChIKey | OCBSIJXWJQVTQF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|