C16H22ClN3O2S — CID 119963849
[1-(8-methylquinolin-5-yl)sulfonylpiperidin-4-yl]methanamine;hydrochloride (PubChem CID 119963849) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is [1-(8-methylquinolin-5-yl)sulfonylpiperidin-4-yl]methanamine;hydrochloride.
| Compound Name | [1-(8-methylquinolin-5-yl)sulfonylpiperidin-4-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119963849 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [1-(8-methylquinolin-5-yl)sulfonylpiperidin-4-yl]methanamine;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(CN)CC2)c2cccnc12.Cl |
| InChI | InChI=1S/C16H21N3O2S.ClH/c1-12-4-5-15(14-3-2-8-18-16(12)14)22(20,21)19-9-6-13(11-17)7-10-19;/h2-5,8,13H,6-7,9-11,17H2,1H3;1H |
| InChIKey | UBHXLBSUZYLBNL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |