C6H10ClNO2 — CID 67918701
(5S)-5-(2-chloroethyl)-3-methyl-1,3-oxazolidin-2-one (PubChem CID 67918701) has the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. Its IUPAC name is (5S)-5-(2-chloroethyl)-3-methyl-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(2-chloroethyl)-3-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67918701 |
| Molecular Formula | C6H10ClNO2 |
| Molecular Weight | 163.60 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | (5S)-5-(2-chloroethyl)-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1C[C@H](CCCl)OC1=O |
| InChI | InChI=1S/C6H10ClNO2/c1-8-4-5(2-3-7)10-6(8)9/h5H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | LRNOHFSJYTYVGW-YFKPBYRVSA-N |
| XLogP | 1.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.60 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|