C8H14N2O2 — CID 158041557
(5R)-5-(3-iminobutyl)-3-methyl-1,3-oxazolidin-2-one (PubChem CID 158041557) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (5R)-5-(3-iminobutyl)-3-methyl-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(3-iminobutyl)-3-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 158041557 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (5R)-5-(3-iminobutyl)-3-methyl-1,3-oxazolidin-2-one |
| SMILES | [H]/N=C(\C)CC[C@@H]1CN(C)C(=O)O1 |
| InChI | InChI=1S/C8H14N2O2/c1-6(9)3-4-7-5-10(2)8(11)12-7/h7,9H,3-5H2,1-2H3/b9-6+/t7-/m1/s1 |
| InChIKey | JVVCUKNVPXQZDT-TUOMEMKJSA-N |
| XLogP | 1.26 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|