C27H29ClN4O2 — CID 157165811
7-[[4-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]-2,5-dimethylpiperazin-1-yl]methyl]-5-methylquinolin-8-ol (PubChem CID 157165811) has the molecular formula C27H29ClN4O2 and a molecular weight of 477.01 g/mol. Its IUPAC name is 7-[[4-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]-2,5-dimethylpiperazin-1-yl]methyl]-5-methylquinolin-8-ol.
| Compound Name | 7-[[4-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]-2,5-dimethylpiperazin-1-yl]methyl]-5-methylquinolin-8-ol |
|---|---|
| PubChem CID | 157165811 |
| Molecular Formula | C27H29ClN4O2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 7-[[4-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]-2,5-dimethylpiperazin-1-yl]methyl]-5-methylquinolin-8-ol |
| SMILES | Cc1cc(CN2CC(C)N(Cc3cc(Cl)c4cccnc4c3O)CC2C)c(O)c2ncccc12 |
| InChI | InChI=1S/C27H29ClN4O2/c1-16-10-19(26(33)24-21(16)6-4-8-29-24)14-31-12-18(3)32(13-17(31)2)15-20-11-23(28)22-7-5-9-30-25(22)27(20)34/h4-11,17-18,33-34H,12-15H2,1-3H3 |
| InChIKey | IUMHQWYEQRDDOM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|