C19H27N3O6 — CID 70352979
but-2-enedioic acid;2-[2-(dimethylamino)ethyl]-4-propan-2-yl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one (PubChem CID 70352979) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is but-2-enedioic acid;2-[2-(dimethylamino)ethyl]-4-propan-2-yl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one.
| Compound Name | but-2-enedioic acid;2-[2-(dimethylamino)ethyl]-4-propan-2-yl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 70352979 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | but-2-enedioic acid;2-[2-(dimethylamino)ethyl]-4-propan-2-yl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one |
| SMILES | CC(C)N1CC(CCN(C)C)Oc2ncccc2C1=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H23N3O2.C4H4O4/c1-11(2)18-10-12(7-9-17(3)4)20-14-13(15(18)19)6-5-8-16-14;5-3(6)1-2-4(7)8/h5-6,8,11-12H,7,9-10H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | NTEOWLHWCBFGLW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|