C25H33N3O5S — CID 21271462
2-[2-[(4-tert-butylphenyl)methyl-methylamino]ethyl]-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepine-5-thione;oxalic acid (PubChem CID 21271462) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is 2-[2-[(4-tert-butylphenyl)methyl-methylamino]ethyl]-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepine-5-thione;oxalic acid.
| Compound Name | 2-[2-[(4-tert-butylphenyl)methyl-methylamino]ethyl]-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepine-5-thione;oxalic acid |
|---|---|
| PubChem CID | 21271462 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 2-[2-[(4-tert-butylphenyl)methyl-methylamino]ethyl]-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepine-5-thione;oxalic acid |
| SMILES | CN(CCC1CN(C)C(=S)c2cccnc2O1)Cc1ccc(C(C)(C)C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H31N3OS.C2H2O4/c1-23(2,3)18-10-8-17(9-11-18)15-25(4)14-12-19-16-26(5)22(28)20-7-6-13-24-21(20)27-19;3-1(4)2(5)6/h6-11,13,19H,12,14-16H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | UZPABVCKWPPSMO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|