C18H19NO2 — CID 95987149
(2S)-2-phenyl-4-propan-2-yl-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 95987149) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2S)-2-phenyl-4-propan-2-yl-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | (2S)-2-phenyl-4-propan-2-yl-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 95987149 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2S)-2-phenyl-4-propan-2-yl-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CC(C)N1C[C@H](c2ccccc2)Oc2ccccc2C1=O |
| InChI | InChI=1S/C18H19NO2/c1-13(2)19-12-17(14-8-4-3-5-9-14)21-16-11-7-6-10-15(16)18(19)20/h3-11,13,17H,12H2,1-2H3/t17-/m1/s1 |
| InChIKey | CKWQGPUUTCWKQT-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |