C21H25N3O6 — CID 70417646
4-(cyclohexa-1,3-dien-1-ylmethyl)-2-[2-(dimethylamino)ethyl]pyrido[3,2-f][1,4]oxazepin-5-one;oxalic acid (PubChem CID 70417646) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-(cyclohexa-1,3-dien-1-ylmethyl)-2-[2-(dimethylamino)ethyl]pyrido[3,2-f][1,4]oxazepin-5-one;oxalic acid.
| Compound Name | 4-(cyclohexa-1,3-dien-1-ylmethyl)-2-[2-(dimethylamino)ethyl]pyrido[3,2-f][1,4]oxazepin-5-one;oxalic acid |
|---|---|
| PubChem CID | 70417646 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-(cyclohexa-1,3-dien-1-ylmethyl)-2-[2-(dimethylamino)ethyl]pyrido[3,2-f][1,4]oxazepin-5-one;oxalic acid |
| SMILES | CN(C)CCC1=CN(CC2=CC=CCC2)C(=O)c2cccnc2O1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H23N3O2.C2H2O4/c1-21(2)12-10-16-14-22(13-15-7-4-3-5-8-15)19(23)17-9-6-11-20-18(17)24-16;3-1(4)2(5)6/h3-4,6-7,9,11,14H,5,8,10,12-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | QOLARJPJMWHLMQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|