C20H23N3O5 — CID 21159625
2-[(E)-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylideneamino]oxy-N,N-dimethylethanamine;oxalic acid (PubChem CID 21159625) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[(E)-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylideneamino]oxy-N,N-dimethylethanamine;oxalic acid.
| Compound Name | 2-[(E)-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylideneamino]oxy-N,N-dimethylethanamine;oxalic acid |
|---|---|
| PubChem CID | 21159625 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[(E)-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylideneamino]oxy-N,N-dimethylethanamine;oxalic acid |
| SMILES | CN(C)CCO/N=C1\c2ccccc2CCc2ncccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H21N3O.C2H2O4/c1-21(2)12-13-22-20-18-15-7-4-3-6-14(15)9-10-17-16(18)8-5-11-19-17;3-1(4)2(5)6/h3-8,11H,9-10,12-13H2,1-2H3;(H,3,4)(H,5,6)/b20-18+; |
| InChIKey | GOGLQGQPNNZVEK-KPJFUTMLSA-N |
| XLogP | 1.67 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|