C14H20N2O — CID 166558413
3-(2,3-dihydroinden-1-ylideneamino)oxy-N,N-dimethylpropan-1-amine (PubChem CID 166558413) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-(2,3-dihydroinden-1-ylideneamino)oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2,3-dihydroinden-1-ylideneamino)oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 166558413 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-(2,3-dihydroinden-1-ylideneamino)oxy-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCON=C1CCc2ccccc21 |
| InChI | InChI=1S/C14H20N2O/c1-16(2)10-5-11-17-15-14-9-8-12-6-3-4-7-13(12)14/h3-4,6-7H,5,8-11H2,1-2H3 |
| InChIKey | KEDFIUSQUAJUGK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|