About (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine
(1E)-1-pentoxyimino-2,3-dihydroinden-5-amine (PubChem CID 166925075) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine.
Molecular Properties
| Compound Name | (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine |
| PubChem CID | 166925075 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine |
| SMILES | CCCCCO/N=C1\CCc2cc(N)ccc21 |
| InChI | InChI=1S/C14H20N2O/c1-2-3-4-9-17-16-14-8-5-11-10-12(15)6-7-13(11)14/h6-7,10H,2-5,8-9,15H2,1H3/b16-14+ |
| InChIKey | RALMVJYYDHLXPL-JQIJEIRASA-N |
| XLogP | 3.13 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine?
The IUPAC name of (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine (CID 166925075) is (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine.
What is the SMILES notation for (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine?
The canonical SMILES for (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine is CCCCCO/N=C1\CCc2cc(N)ccc21.
What is the InChIKey of (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine?
The InChIKey is RALMVJYYDHLXPL-JQIJEIRASA-N. The full InChI is InChI=1S/C14H20N2O/c1-2-3-4-9-17-16-14-8-5-11-10-12(15)6-7-13(11)14/h6-7,10H,2-5,8-9,15H2,1H3/b16-14+.
What are the key properties of (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine?
(1E)-1-pentoxyimino-2,3-dihydroinden-5-amine has a molecular weight of 232.33 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine is sourced from PubChem (CID 166925075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).