C14H20N2O — CID 166925075
(1E)-1-pentoxyimino-2,3-dihydroinden-5-amine (PubChem CID 166925075) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine.
| Compound Name | (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine |
|---|---|
| PubChem CID | 166925075 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (1E)-1-pentoxyimino-2,3-dihydroinden-5-amine |
| SMILES | CCCCCO/N=C1\CCc2cc(N)ccc21 |
| InChI | InChI=1S/C14H20N2O/c1-2-3-4-9-17-16-14-8-5-11-10-12(15)6-7-13(11)14/h6-7,10H,2-5,8-9,15H2,1H3/b16-14+ |
| InChIKey | RALMVJYYDHLXPL-JQIJEIRASA-N |
| XLogP | 3.13 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|