C12H15N — CID 79879504
1-propylidene-2,3-dihydroinden-5-amine (PubChem CID 79879504) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-propylidene-2,3-dihydroinden-5-amine.
| Compound Name | 1-propylidene-2,3-dihydroinden-5-amine |
|---|---|
| PubChem CID | 79879504 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-propylidene-2,3-dihydroinden-5-amine |
| SMILES | CCC=C1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C12H15N/c1-2-3-9-4-5-10-8-11(13)6-7-12(9)10/h3,6-8H,2,4-5,13H2,1H3 |
| InChIKey | JVLUISAGNWDCDX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|