C14H20 — CID 143438466
ethane;(3E)-3-propylidene-1,2-dihydroindene (PubChem CID 143438466) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is ethane;(3E)-3-propylidene-1,2-dihydroindene.
| Compound Name | ethane;(3E)-3-propylidene-1,2-dihydroindene |
|---|---|
| PubChem CID | 143438466 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | ethane;(3E)-3-propylidene-1,2-dihydroindene |
| SMILES | CC.CC/C=C1\CCc2ccccc21 |
| InChI | InChI=1S/C12H14.C2H6/c1-2-5-10-8-9-11-6-3-4-7-12(10)11;1-2/h3-7H,2,8-9H2,1H3;1-2H3/b10-5+; |
| InChIKey | HIBXEINPIPGEQI-OAZHBLANSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |