C15H20O — CID 91507924
ethane;1-propylidene-3,4-dihydronaphthalen-2-one (PubChem CID 91507924) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is ethane;1-propylidene-3,4-dihydronaphthalen-2-one.
| Compound Name | ethane;1-propylidene-3,4-dihydronaphthalen-2-one |
|---|---|
| PubChem CID | 91507924 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | ethane;1-propylidene-3,4-dihydronaphthalen-2-one |
| SMILES | CC.CCC=C1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C13H14O.C2H6/c1-2-5-12-11-7-4-3-6-10(11)8-9-13(12)14;1-2/h3-7H,2,8-9H2,1H3;1-2H3 |
| InChIKey | DFZMOVXKVYTOSX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|