C20H21N — CID 10492669
(2E)-2-benzylidene-N-propyl-3,4-dihydronaphthalen-1-imine (PubChem CID 10492669) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is (2E)-2-benzylidene-N-propyl-3,4-dihydronaphthalen-1-imine.
| Compound Name | (2E)-2-benzylidene-N-propyl-3,4-dihydronaphthalen-1-imine |
|---|---|
| PubChem CID | 10492669 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (2E)-2-benzylidene-N-propyl-3,4-dihydronaphthalen-1-imine |
| SMILES | CCC/N=C1C(=C/c2ccccc2)/CCc2ccccc2/1 |
| InChI | InChI=1S/C20H21N/c1-2-14-21-20-18(15-16-8-4-3-5-9-16)13-12-17-10-6-7-11-19(17)20/h3-11,15H,2,12-14H2,1H3/b18-15+,21-20- |
| InChIKey | YLKFQOWTWHSEAI-MOOSWKITSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|