C18H19N — CID 6508665
4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]-N,N-dimethylaniline (PubChem CID 6508665) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 6508665 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-[(Z)-2,3-dihydroinden-1-ylidenemethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C2/CCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H19N/c1-19(2)17-11-7-14(8-12-17)13-16-10-9-15-5-3-4-6-18(15)16/h3-8,11-13H,9-10H2,1-2H3/b16-13- |
| InChIKey | XGXYPOJSHFIRHQ-SSZFMOIBSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|