C25H23NO — CID 23265611
(2E)-2-[[4-(dimethylamino)phenyl]methylidene]-4-phenyl-3,4-dihydronaphthalen-1-one (PubChem CID 23265611) has the molecular formula C25H23NO and a molecular weight of 353.47 g/mol. Its IUPAC name is (2E)-2-[[4-(dimethylamino)phenyl]methylidene]-4-phenyl-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[[4-(dimethylamino)phenyl]methylidene]-4-phenyl-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 23265611 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (2E)-2-[[4-(dimethylamino)phenyl]methylidene]-4-phenyl-3,4-dihydronaphthalen-1-one |
| SMILES | CN(C)c1ccc(/C=C2\CC(c3ccccc3)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H23NO/c1-26(2)21-14-12-18(13-15-21)16-20-17-24(19-8-4-3-5-9-19)22-10-6-7-11-23(22)25(20)27/h3-16,24H,17H2,1-2H3/b20-16+ |
| InChIKey | LLKOFWLQWWDTMQ-CAPFRKAQSA-N |
| XLogP | 5.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|