C31H36N3+ — CID 44669203
[(2E,6E)-2,6-bis[[4-(dimethylamino)phenyl]methylidene]cyclohexylidene]-methyl-phenylazanium (PubChem CID 44669203) has the molecular formula C31H36N3+ and a molecular weight of 450.65 g/mol. Its IUPAC name is [(2E,6E)-2,6-bis[[4-(dimethylamino)phenyl]methylidene]cyclohexylidene]-methyl-phenylazanium.
| Compound Name | [(2E,6E)-2,6-bis[[4-(dimethylamino)phenyl]methylidene]cyclohexylidene]-methyl-phenylazanium |
|---|---|
| PubChem CID | 44669203 |
| Molecular Formula | C31H36N3+ |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | [(2E,6E)-2,6-bis[[4-(dimethylamino)phenyl]methylidene]cyclohexylidene]-methyl-phenylazanium |
| SMILES | CN(C)c1ccc(/C=C2\CCC/C(=C\c3ccc(N(C)C)cc3)C2=[N+](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H36N3/c1-32(2)28-18-14-24(15-19-28)22-26-10-9-11-27(23-25-16-20-29(21-17-25)33(3)4)31(26)34(5)30-12-7-6-8-13-30/h6-8,12-23H,9-11H2,1-5H3/q+1 |
| InChIKey | XAWOPLYWDQDUGP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|