C23H27ClN2O4 — CID 12545837
4-[(E)-(10,10-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]indol-5-ium-9-ylidene)methyl]-N,N-dimethylaniline perchlorate (PubChem CID 12545837) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is 4-[(E)-(10,10-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]indol-5-ium-9-ylidene)methyl]-N,N-dimethylaniline perchlorate.
| Compound Name | 4-[(E)-(10,10-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]indol-5-ium-9-ylidene)methyl]-N,N-dimethylaniline perchlorate |
|---|---|
| PubChem CID | 12545837 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-[(E)-(10,10-dimethyl-7,8-dihydro-6H-pyrido[1,2-a]indol-5-ium-9-ylidene)methyl]-N,N-dimethylaniline perchlorate |
| SMILES | CN(C)c1ccc(/C=C2\CCC[N+]3=C2C(C)(C)c2ccccc23)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H27N2.ClHO4/c1-23(2)20-9-5-6-10-21(20)25-15-7-8-18(22(23)25)16-17-11-13-19(14-12-17)24(3)4;2-1(3,4)5/h5-6,9-14,16H,7-8,15H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | WYZNROQVVUOAPP-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|