C19H23N2+ — CID 58659925
N,N-dimethyl-4-(1,3,3-trimethylindol-1-ium-2-yl)aniline (PubChem CID 58659925) has the molecular formula C19H23N2+ and a molecular weight of 279.41 g/mol. Its IUPAC name is N,N-dimethyl-4-(1,3,3-trimethylindol-1-ium-2-yl)aniline.
| Compound Name | N,N-dimethyl-4-(1,3,3-trimethylindol-1-ium-2-yl)aniline |
|---|---|
| PubChem CID | 58659925 |
| Molecular Formula | C19H23N2+ |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N,N-dimethyl-4-(1,3,3-trimethylindol-1-ium-2-yl)aniline |
| SMILES | CN(C)c1ccc(C2=[N+](C)c3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C19H23N2/c1-19(2)16-8-6-7-9-17(16)21(5)18(19)14-10-12-15(13-11-14)20(3)4/h6-13H,1-5H3/q+1 |
| InChIKey | UGOBXPYUHWTQPU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|