C20H25N2Si+ — CID 123780097
N,N-dimethyl-4-[2-(1,3,3-trimethyl-1,2-benzazasilol-1-ium-2-yl)ethenyl]aniline (PubChem CID 123780097) has the molecular formula C20H25N2Si+ and a molecular weight of 321.52 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(1,3,3-trimethyl-1,2-benzazasilol-1-ium-2-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(1,3,3-trimethyl-1,2-benzazasilol-1-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 123780097 |
| Molecular Formula | C20H25N2Si+ |
| Molecular Weight | 321.52 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N,N-dimethyl-4-[2-(1,3,3-trimethyl-1,2-benzazasilol-1-ium-2-yl)ethenyl]aniline |
| SMILES | CN(C)c1ccc(C=C[Si]2=[N+](C)c3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C20H25N2Si/c1-20(2)18-8-6-7-9-19(18)22(5)23(20)15-14-16-10-12-17(13-11-16)21(3)4/h6-15H,1-5H3/q+1 |
| InChIKey | ALOJBDKHBLQGLF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|