C27H33N2+ — CID 118403591
4-[(1E,3E)-4-(1'-ethylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)buta-1,3-dienyl]-N,N-dimethylaniline (PubChem CID 118403591) has the molecular formula C27H33N2+ and a molecular weight of 385.58 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(1'-ethylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)buta-1,3-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1E,3E)-4-(1'-ethylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)buta-1,3-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 118403591 |
| Molecular Formula | C27H33N2+ |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 4-[(1E,3E)-4-(1'-ethylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)buta-1,3-dienyl]-N,N-dimethylaniline |
| SMILES | CC[N+]1=C(/C=C/C=C/c2ccc(N(C)C)cc2)C2(CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C27H33N2/c1-4-29-25-14-8-7-13-24(25)27(20-10-5-11-21-27)26(29)15-9-6-12-22-16-18-23(19-17-22)28(2)3/h6-9,12-19H,4-5,10-11,20-21H2,1-3H3/q+1 |
| InChIKey | WLQMPXULEQSDOW-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|