About 4-butylidene-2,3-dihydro-1H-naphthalene
4-butylidene-2,3-dihydro-1H-naphthalene (PubChem CID 123805104) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-butylidene-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 4-butylidene-2,3-dihydro-1H-naphthalene |
| PubChem CID | 123805104 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 4-butylidene-2,3-dihydro-1H-naphthalene |
| SMILES | CCCC=C1CCCc2ccccc21 |
| InChI | InChI=1S/C14H18/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13/h4-5,7-8,11H,2-3,6,9-10H2,1H3 |
| InChIKey | LUGUFXMLRBLNIE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-butylidene-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylidene-2,3-dihydro-1H-naphthalene?
The IUPAC name of 4-butylidene-2,3-dihydro-1H-naphthalene (CID 123805104) is 4-butylidene-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for 4-butylidene-2,3-dihydro-1H-naphthalene?
The canonical SMILES for 4-butylidene-2,3-dihydro-1H-naphthalene is CCCC=C1CCCc2ccccc21.
What is the InChIKey of 4-butylidene-2,3-dihydro-1H-naphthalene?
The InChIKey is LUGUFXMLRBLNIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13/h4-5,7-8,11H,2-3,6,9-10H2,1H3.
What are the key properties of 4-butylidene-2,3-dihydro-1H-naphthalene?
4-butylidene-2,3-dihydro-1H-naphthalene has a molecular weight of 186.30 g/mol, XLogP of 4.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylidene-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 123805104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).