C31H29N3 — CID 177385814
N-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]-N-phenylaniline (PubChem CID 177385814) has the molecular formula C31H29N3 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]-N-phenylaniline.
| Compound Name | N-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]-N-phenylaniline |
|---|---|
| PubChem CID | 177385814 |
| Molecular Formula | C31H29N3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | N-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]-N-phenylaniline |
| SMILES | CN(/N=C/c1ccc(N(/C=C2\CCCc3ccccc32)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H29N3/c1-33(28-14-4-2-5-15-28)32-23-25-19-21-30(22-20-25)34(29-16-6-3-7-17-29)24-27-13-10-12-26-11-8-9-18-31(26)27/h2-9,11,14-24H,10,12-13H2,1H3/b27-24+,32-23+ |
| InChIKey | KCFWFEQQTYJXMP-JXPNCPDRSA-N |
| XLogP | 7.67 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|