C20H24Cl2N2O — CID 138398784
N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylideneamino)oxypropan-1-amine;dihydrochloride (PubChem CID 138398784) has the molecular formula C20H24Cl2N2O and a molecular weight of 379.33 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylideneamino)oxypropan-1-amine;dihydrochloride.
| Compound Name | N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylideneamino)oxypropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 138398784 |
| Molecular Formula | C20H24Cl2N2O |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylideneamino)oxypropan-1-amine;dihydrochloride |
| SMILES | CN(C)CCCON=c1c2ccccc2ccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C20H22N2O.2ClH/c1-22(2)14-7-15-23-21-20-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)20;;/h3-6,8-13H,7,14-15H2,1-2H3;2*1H |
| InChIKey | VLYKCBDJFPJZFL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|