C19H19ClN2O — CID 5360663
2-[(Z)-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)amino]oxy-N,N-dimethylethanamine (PubChem CID 5360663) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-[(Z)-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)amino]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[(Z)-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)amino]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 5360663 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[(Z)-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)amino]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCO/N=c1/c2ccccc2ccc2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H19ClN2O/c1-22(2)11-12-23-21-19-17-6-4-3-5-14(17)7-8-15-9-10-16(20)13-18(15)19/h3-10,13H,11-12H2,1-2H3/b21-19- |
| InChIKey | HBSUQWXKPKMKIJ-VZCXRCSSSA-N |
| XLogP | 4.04 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|